C17H17ClN2O6 — CID 7359007
[2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 3-chloro-5-ethoxy-4-hydroxybenzoate (PubChem CID 7359007) has the molecular formula C17H17ClN2O6 and a molecular weight of 380.78 g/mol. Its IUPAC name is [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 3-chloro-5-ethoxy-4-hydroxybenzoate.
| Compound Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 3-chloro-5-ethoxy-4-hydroxybenzoate |
|---|---|
| PubChem CID | 7359007 |
| Molecular Formula | C17H17ClN2O6 |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 3-chloro-5-ethoxy-4-hydroxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)NC(=O)c2cccn2C)cc(Cl)c1O |
| InChI | InChI=1S/C17H17ClN2O6/c1-3-25-13-8-10(7-11(18)15(13)22)17(24)26-9-14(21)19-16(23)12-5-4-6-20(12)2/h4-8,22H,3,9H2,1-2H3,(H,19,21,23) |
| InChIKey | JDTOLFSTGKSEKB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |