C13H13N3O6S2 — CID 27936391
[2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate (PubChem CID 27936391) has the molecular formula C13H13N3O6S2 and a molecular weight of 371.40 g/mol. Its IUPAC name is [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate.
| Compound Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 27936391 |
| Molecular Formula | C13H13N3O6S2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate |
| SMILES | Cn1cccc1C(=O)NC(=O)COC(=O)c1csc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H13N3O6S2/c1-16-4-2-3-9(16)12(18)15-10(17)6-22-13(19)8-5-11(23-7-8)24(14,20)21/h2-5,7H,6H2,1H3,(H2,14,20,21)(H,15,17,18) |
| InChIKey | LSMAGDRAKBAGBN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 137.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |