C12H16N2O5S2 — CID 27936183
[2-(cyclopentylamino)-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate (PubChem CID 27936183) has the molecular formula C12H16N2O5S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 27936183 |
| Molecular Formula | C12H16N2O5S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate |
| SMILES | NS(=O)(=O)c1cc(C(=O)OCC(=O)NC2CCCC2)cs1 |
| InChI | InChI=1S/C12H16N2O5S2/c13-21(17,18)11-5-8(7-20-11)12(16)19-6-10(15)14-9-3-1-2-4-9/h5,7,9H,1-4,6H2,(H,14,15)(H2,13,17,18) |
| InChIKey | BERLPVTWESRUMG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |