C21H21NO4 — CID 2606533
[2-(cyclopentylamino)-2-oxoethyl] 4-benzoylbenzoate (PubChem CID 2606533) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 4-benzoylbenzoate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 2606533 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 4-benzoylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(C(=O)c2ccccc2)cc1)NC1CCCC1 |
| InChI | InChI=1S/C21H21NO4/c23-19(22-18-8-4-5-9-18)14-26-21(25)17-12-10-16(11-13-17)20(24)15-6-2-1-3-7-15/h1-3,6-7,10-13,18H,4-5,8-9,14H2,(H,22,23) |
| InChIKey | ZDCQSGVPKFRKNR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |