C8H8ClNO4S2 — CID 30589125
2-chloroprop-2-enyl 5-sulfamoylthiophene-3-carboxylate (PubChem CID 30589125) has the molecular formula C8H8ClNO4S2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-chloroprop-2-enyl 5-sulfamoylthiophene-3-carboxylate.
| Compound Name | 2-chloroprop-2-enyl 5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 30589125 |
| Molecular Formula | C8H8ClNO4S2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 280.96 |
| IUPAC Name | 2-chloroprop-2-enyl 5-sulfamoylthiophene-3-carboxylate |
| SMILES | C=C(Cl)COC(=O)c1csc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C8H8ClNO4S2/c1-5(9)3-14-8(11)6-2-7(15-4-6)16(10,12)13/h2,4H,1,3H2,(H2,10,12,13) |
| InChIKey | KRLPOHPRARLCJF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |