C14H12ClNO6S2 — CID 24531102
[2-(3-chloro-4-methoxyphenyl)-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate (PubChem CID 24531102) has the molecular formula C14H12ClNO6S2 and a molecular weight of 389.84 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyphenyl)-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate.
| Compound Name | [2-(3-chloro-4-methoxyphenyl)-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 24531102 |
| Molecular Formula | C14H12ClNO6S2 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | [2-(3-chloro-4-methoxyphenyl)-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)c2csc(S(N)(=O)=O)c2)cc1Cl |
| InChI | InChI=1S/C14H12ClNO6S2/c1-21-12-3-2-8(4-10(12)15)11(17)6-22-14(18)9-5-13(23-7-9)24(16,19)20/h2-5,7H,6H2,1H3,(H2,16,19,20) |
| InChIKey | TYIFYJMOQCMHRQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |