C21H24ClNO6S — CID 32829104
[2-(3-chloro-4-methoxyphenyl)-2-oxoethyl] 5-(diethylsulfamoyl)-2-methylbenzoate (PubChem CID 32829104) has the molecular formula C21H24ClNO6S and a molecular weight of 453.94 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyphenyl)-2-oxoethyl] 5-(diethylsulfamoyl)-2-methylbenzoate.
| Compound Name | [2-(3-chloro-4-methoxyphenyl)-2-oxoethyl] 5-(diethylsulfamoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 32829104 |
| Molecular Formula | C21H24ClNO6S |
| Molecular Weight | 453.94 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | [2-(3-chloro-4-methoxyphenyl)-2-oxoethyl] 5-(diethylsulfamoyl)-2-methylbenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)OCC(=O)c2ccc(OC)c(Cl)c2)c1 |
| InChI | InChI=1S/C21H24ClNO6S/c1-5-23(6-2)30(26,27)16-9-7-14(3)17(12-16)21(25)29-13-19(24)15-8-10-20(28-4)18(22)11-15/h7-12H,5-6,13H2,1-4H3 |
| InChIKey | PAWQUOPKIPAWOA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.94 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |