C18H28N2O6S — CID 55320330
[2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 5-(diethylsulfamoyl)-2-methylbenzoate (PubChem CID 55320330) has the molecular formula C18H28N2O6S and a molecular weight of 400.50 g/mol. Its IUPAC name is [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 5-(diethylsulfamoyl)-2-methylbenzoate.
| Compound Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 5-(diethylsulfamoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 55320330 |
| Molecular Formula | C18H28N2O6S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 5-(diethylsulfamoyl)-2-methylbenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)OCC(=O)NC(C)COC)c1 |
| InChI | InChI=1S/C18H28N2O6S/c1-6-20(7-2)27(23,24)15-9-8-13(3)16(10-15)18(22)26-12-17(21)19-14(4)11-25-5/h8-10,14H,6-7,11-12H2,1-5H3,(H,19,21) |
| InChIKey | OENNEVLLGWOGJF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |