C17H24N2O5S — CID 46679679
[2-(butan-2-ylamino)-2-oxoethyl] 5-(cyclopropylsulfamoyl)-2-methylbenzoate (PubChem CID 46679679) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is [2-(butan-2-ylamino)-2-oxoethyl] 5-(cyclopropylsulfamoyl)-2-methylbenzoate.
| Compound Name | [2-(butan-2-ylamino)-2-oxoethyl] 5-(cyclopropylsulfamoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 46679679 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [2-(butan-2-ylamino)-2-oxoethyl] 5-(cyclopropylsulfamoyl)-2-methylbenzoate |
| SMILES | CCC(C)NC(=O)COC(=O)c1cc(S(=O)(=O)NC2CC2)ccc1C |
| InChI | InChI=1S/C17H24N2O5S/c1-4-12(3)18-16(20)10-24-17(21)15-9-14(8-5-11(15)2)25(22,23)19-13-6-7-13/h5,8-9,12-13,19H,4,6-7,10H2,1-3H3,(H,18,20) |
| InChIKey | AWDOOQVRWBLCEN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |