C18H26N2O5S — CID 46679220
[2-(3-methylbutan-2-ylamino)-2-oxoethyl] 5-(cyclopropylsulfamoyl)-2-methylbenzoate (PubChem CID 46679220) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is [2-(3-methylbutan-2-ylamino)-2-oxoethyl] 5-(cyclopropylsulfamoyl)-2-methylbenzoate.
| Compound Name | [2-(3-methylbutan-2-ylamino)-2-oxoethyl] 5-(cyclopropylsulfamoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 46679220 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [2-(3-methylbutan-2-ylamino)-2-oxoethyl] 5-(cyclopropylsulfamoyl)-2-methylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)NC2CC2)cc1C(=O)OCC(=O)NC(C)C(C)C |
| InChI | InChI=1S/C18H26N2O5S/c1-11(2)13(4)19-17(21)10-25-18(22)16-9-15(8-5-12(16)3)26(23,24)20-14-6-7-14/h5,8-9,11,13-14,20H,6-7,10H2,1-4H3,(H,19,21) |
| InChIKey | JGYYCYALLDIHBP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |