C18H18ClNO4S — CID 55490032
(4-chlorophenyl)methyl 5-(cyclopropylsulfamoyl)-2-methylbenzoate (PubChem CID 55490032) has the molecular formula C18H18ClNO4S and a molecular weight of 379.87 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 5-(cyclopropylsulfamoyl)-2-methylbenzoate.
| Compound Name | (4-chlorophenyl)methyl 5-(cyclopropylsulfamoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 55490032 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | (4-chlorophenyl)methyl 5-(cyclopropylsulfamoyl)-2-methylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)NC2CC2)cc1C(=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClNO4S/c1-12-2-9-16(25(22,23)20-15-7-8-15)10-17(12)18(21)24-11-13-3-5-14(19)6-4-13/h2-6,9-10,15,20H,7-8,11H2,1H3 |
| InChIKey | QXOOXSPDMQMQBS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |