C25H21NO6S — CID 46679378
(3-oxobenzo[f]chromen-1-yl)methyl 5-(cyclopropylsulfamoyl)-2-methylbenzoate (PubChem CID 46679378) has the molecular formula C25H21NO6S and a molecular weight of 463.51 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 5-(cyclopropylsulfamoyl)-2-methylbenzoate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 5-(cyclopropylsulfamoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 46679378 |
| Molecular Formula | C25H21NO6S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 5-(cyclopropylsulfamoyl)-2-methylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)NC2CC2)cc1C(=O)OCc1cc(=O)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C25H21NO6S/c1-15-6-10-19(33(29,30)26-18-8-9-18)13-21(15)25(28)31-14-17-12-23(27)32-22-11-7-16-4-2-3-5-20(16)24(17)22/h2-7,10-13,18,26H,8-9,14H2,1H3 |
| InChIKey | XNMUYGCXCZZDJC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|