C24H21NO6S — CID 2602511
(3-oxobenzo[f]chromen-1-yl)methyl 3-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 2602511) has the molecular formula C24H21NO6S and a molecular weight of 451.50 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 3-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 3-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 2602511 |
| Molecular Formula | C24H21NO6S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 3-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)OCc2cc(=O)oc3ccc4ccccc4c23)cc1 |
| InChI | InChI=1S/C24H21NO6S/c1-16-6-9-19(10-7-16)32(28,29)25-13-12-22(26)30-15-18-14-23(27)31-21-11-8-17-4-2-3-5-20(17)24(18)21/h2-11,14,25H,12-13,15H2,1H3 |
| InChIKey | NLIMJVYIGMQJHL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|