C24H25NO7S — CID 29193997
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate (PubChem CID 29193997) has the molecular formula C24H25NO7S and a molecular weight of 471.53 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 29193997 |
| Molecular Formula | C24H25NO7S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(=O)OCc2cc(=O)oc3cc4c(cc23)CCC4)cc1 |
| InChI | InChI=1S/C24H25NO7S/c1-2-30-19-6-8-20(9-7-19)33(28,29)25-11-10-23(26)31-15-18-14-24(27)32-22-13-17-5-3-4-16(17)12-21(18)22/h6-9,12-14,25H,2-5,10-11,15H2,1H3 |
| InChIKey | HDNHHBXHAIBONN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|