C22H20N2O6 — CID 55517902
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3-(2-nitroanilino)propanoate (PubChem CID 55517902) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3-(2-nitroanilino)propanoate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3-(2-nitroanilino)propanoate |
|---|---|
| PubChem CID | 55517902 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3-(2-nitroanilino)propanoate |
| SMILES | O=C(CCNc1ccccc1[N+](=O)[O-])OCc1cc(=O)oc2cc3c(cc12)CCC3 |
| InChI | InChI=1S/C22H20N2O6/c25-21(8-9-23-18-6-1-2-7-19(18)24(27)28)29-13-16-12-22(26)30-20-11-15-5-3-4-14(15)10-17(16)20/h1-2,6-7,10-12,23H,3-5,8-9,13H2 |
| InChIKey | CFNYAWGUQIMRKM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|