C21H21N3O4 — CID 46612747
2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)-N-[2-(2-nitroanilino)ethyl]acetamide (PubChem CID 46612747) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)-N-[2-(2-nitroanilino)ethyl]acetamide.
| Compound Name | 2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)-N-[2-(2-nitroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 46612747 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)-N-[2-(2-nitroanilino)ethyl]acetamide |
| SMILES | O=C(Cc1coc2cc3c(cc12)CCC3)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21N3O4/c25-21(23-9-8-22-18-6-1-2-7-19(18)24(26)27)12-16-13-28-20-11-15-5-3-4-14(15)10-17(16)20/h1-2,6-7,10-11,13,22H,3-5,8-9,12H2,(H,23,25) |
| InChIKey | KHDFJCGGENDSDY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|