C23H24N2O4 — CID 60532623
N-[2-[[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]amino]ethyl]-4-methoxybenzamide (PubChem CID 60532623) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[2-[[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]amino]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]amino]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 60532623 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[2-[[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]amino]ethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)Cc2coc3cc4c(cc23)CCC4)cc1 |
| InChI | InChI=1S/C23H24N2O4/c1-28-19-7-5-15(6-8-19)23(27)25-10-9-24-22(26)13-18-14-29-21-12-17-4-2-3-16(17)11-20(18)21/h5-8,11-12,14H,2-4,9-10,13H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | PZMRJZGWDROYDE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|