C24H26N2O5 — CID 35428235
N'-[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]-3-methoxy-4-propoxybenzohydrazide (PubChem CID 35428235) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is N'-[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]-3-methoxy-4-propoxybenzohydrazide.
| Compound Name | N'-[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]-3-methoxy-4-propoxybenzohydrazide |
|---|---|
| PubChem CID | 35428235 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N'-[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]-3-methoxy-4-propoxybenzohydrazide |
| SMILES | CCCOc1ccc(C(=O)NNC(=O)Cc2coc3cc4c(cc23)CCC4)cc1OC |
| InChI | InChI=1S/C24H26N2O5/c1-3-9-30-20-8-7-17(12-22(20)29-2)24(28)26-25-23(27)13-18-14-31-21-11-16-6-4-5-15(16)10-19(18)21/h7-8,10-12,14H,3-6,9,13H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | CARDKJXERNTKCV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|