C20H23NO6 — CID 33242600
diethyl 2-[[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]amino]propanedioate (PubChem CID 33242600) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is diethyl 2-[[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]amino]propanedioate.
| Compound Name | diethyl 2-[[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]amino]propanedioate |
|---|---|
| PubChem CID | 33242600 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | diethyl 2-[[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)Cc1coc2cc3c(cc12)CCC3)C(=O)OCC |
| InChI | InChI=1S/C20H23NO6/c1-3-25-19(23)18(20(24)26-4-2)21-17(22)10-14-11-27-16-9-13-7-5-6-12(13)8-15(14)16/h8-9,11,18H,3-7,10H2,1-2H3,(H,21,22) |
| InChIKey | YBHYHBWZYCGBSX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|