C19H21NO4 — CID 120693190
(E)-2-[[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]amino]hex-4-enoic acid (PubChem CID 120693190) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (E)-2-[[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693190 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (E)-2-[[2-(6,7-dihydro-5H-cyclopenta[f][1]benzofuran-3-yl)acetyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)Cc1coc2cc3c(cc12)CCC3)C(=O)O |
| InChI | InChI=1S/C19H21NO4/c1-2-3-7-16(19(22)23)20-18(21)10-14-11-24-17-9-13-6-4-5-12(13)8-15(14)17/h2-3,8-9,11,16H,4-7,10H2,1H3,(H,20,21)(H,22,23)/b3-2+ |
| InChIKey | NVRLIXYUEPJKLC-NSCUHMNNSA-N |
| XLogP | 3.00 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|