C18H23NO4 — CID 120693475
(E)-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]hex-4-enoic acid (PubChem CID 120693475) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is (E)-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693475 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (E)-2-[[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)acetyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)COc1ccc2c(c1)CCCC2)C(=O)O |
| InChI | InChI=1S/C18H23NO4/c1-2-3-8-16(18(21)22)19-17(20)12-23-15-10-9-13-6-4-5-7-14(13)11-15/h2-3,9-11,16H,4-8,12H2,1H3,(H,19,20)(H,21,22)/b3-2+ |
| InChIKey | SJGUFSMWDVPTOB-NSCUHMNNSA-N |
| XLogP | 2.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|