C17H22BrNO4 — CID 120694246
(E)-2-[5-(4-bromophenoxy)pentanoylamino]hex-4-enoic acid (PubChem CID 120694246) has the molecular formula C17H22BrNO4 and a molecular weight of 384.27 g/mol. Its IUPAC name is (E)-2-[5-(4-bromophenoxy)pentanoylamino]hex-4-enoic acid.
| Compound Name | (E)-2-[5-(4-bromophenoxy)pentanoylamino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120694246 |
| Molecular Formula | C17H22BrNO4 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | (E)-2-[5-(4-bromophenoxy)pentanoylamino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)CCCCOc1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C17H22BrNO4/c1-2-3-6-15(17(21)22)19-16(20)7-4-5-12-23-14-10-8-13(18)9-11-14/h2-3,8-11,15H,4-7,12H2,1H3,(H,19,20)(H,21,22)/b3-2+ |
| InChIKey | HBSLCHJXLWACOR-NSCUHMNNSA-N |
| XLogP | 3.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|