C16H21NO4S — CID 120692650
(E)-2-[3-(4-methoxyphenyl)sulfanylpropanoylamino]hex-4-enoic acid (PubChem CID 120692650) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is (E)-2-[3-(4-methoxyphenyl)sulfanylpropanoylamino]hex-4-enoic acid.
| Compound Name | (E)-2-[3-(4-methoxyphenyl)sulfanylpropanoylamino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120692650 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (E)-2-[3-(4-methoxyphenyl)sulfanylpropanoylamino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)CCSc1ccc(OC)cc1)C(=O)O |
| InChI | InChI=1S/C16H21NO4S/c1-3-4-5-14(16(19)20)17-15(18)10-11-22-13-8-6-12(21-2)7-9-13/h3-4,6-9,14H,5,10-11H2,1-2H3,(H,17,18)(H,19,20)/b4-3+ |
| InChIKey | KIWKDIWHSGUBAE-ONEGZZNKSA-N |
| XLogP | 2.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|