C23H23NO2S — CID 41486489
N-benzhydryl-3-(4-methoxyphenyl)sulfanylpropanamide (PubChem CID 41486489) has the molecular formula C23H23NO2S and a molecular weight of 377.51 g/mol. Its IUPAC name is N-benzhydryl-3-(4-methoxyphenyl)sulfanylpropanamide.
| Compound Name | N-benzhydryl-3-(4-methoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 41486489 |
| Molecular Formula | C23H23NO2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-benzhydryl-3-(4-methoxyphenyl)sulfanylpropanamide |
| SMILES | COc1ccc(SCCC(=O)NC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO2S/c1-26-20-12-14-21(15-13-20)27-17-16-22(25)24-23(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,23H,16-17H2,1H3,(H,24,25) |
| InChIKey | HZSLQJHVIQKRCR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |