C21H27NO3S — CID 55536116
3-(4-methoxyphenyl)sulfanyl-N-[3-(1-phenylethoxy)propyl]propanamide (PubChem CID 55536116) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfanyl-N-[3-(1-phenylethoxy)propyl]propanamide.
| Compound Name | 3-(4-methoxyphenyl)sulfanyl-N-[3-(1-phenylethoxy)propyl]propanamide |
|---|---|
| PubChem CID | 55536116 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfanyl-N-[3-(1-phenylethoxy)propyl]propanamide |
| SMILES | COc1ccc(SCCC(=O)NCCCOC(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27NO3S/c1-17(18-7-4-3-5-8-18)25-15-6-14-22-21(23)13-16-26-20-11-9-19(24-2)10-12-20/h3-5,7-12,17H,6,13-16H2,1-2H3,(H,22,23) |
| InChIKey | CPBBTVRHFNMELV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|