C25H27NO3 — CID 30390615
4-(4-methoxyphenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]butanamide (PubChem CID 30390615) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]butanamide.
| Compound Name | 4-(4-methoxyphenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]butanamide |
|---|---|
| PubChem CID | 30390615 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 4-(4-methoxyphenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]butanamide |
| SMILES | COc1ccc(OCCCC(=O)N[C@H](c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H27NO3/c1-19-10-12-21(13-11-19)25(20-7-4-3-5-8-20)26-24(27)9-6-18-29-23-16-14-22(28-2)15-17-23/h3-5,7-8,10-17,25H,6,9,18H2,1-2H3,(H,26,27)/t25-/m1/s1 |
| InChIKey | JFWHVIGTBSUKPX-RUZDIDTESA-N |
| XLogP | 5.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|