C28H25NO2 — CID 2964251
2-(4-methoxyphenyl)-N-[phenyl-(4-phenylphenyl)methyl]acetamide (PubChem CID 2964251) has the molecular formula C28H25NO2 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[phenyl-(4-phenylphenyl)methyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[phenyl-(4-phenylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 2964251 |
| Molecular Formula | C28H25NO2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[phenyl-(4-phenylphenyl)methyl]acetamide |
| SMILES | COc1ccc(CC(=O)NC(c2ccccc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H25NO2/c1-31-26-18-12-21(13-19-26)20-27(30)29-28(24-10-6-3-7-11-24)25-16-14-23(15-17-25)22-8-4-2-5-9-22/h2-19,28H,20H2,1H3,(H,29,30) |
| InChIKey | IBLAOOBACAVZQL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |