C25H25NO4 — CID 8011640
[(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-(4-methoxyphenyl)acetate (PubChem CID 8011640) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is [(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-(4-methoxyphenyl)acetate.
| Compound Name | [(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8011640 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [(2S)-1-(benzhydrylamino)-1-oxopropan-2-yl] 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)O[C@@H](C)C(=O)NC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO4/c1-18(30-23(27)17-19-13-15-22(29-2)16-14-19)25(28)26-24(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,18,24H,17H2,1-2H3,(H,26,28)/t18-/m0/s1 |
| InChIKey | IGXJZHOEYAPYJN-SFHVURJKSA-N |
| XLogP | 4.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |