C18H25NO4 — CID 42900696
[1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(4-methoxyphenyl)acetate (PubChem CID 42900696) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is [1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(4-methoxyphenyl)acetate.
| Compound Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 42900696 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OC(C)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H25NO4/c1-13(18(21)19-15-6-4-3-5-7-15)23-17(20)12-14-8-10-16(22-2)11-9-14/h8-11,13,15H,3-7,12H2,1-2H3,(H,19,21) |
| InChIKey | IKGJTCOWIZRUBM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |