C17H20N2O4 — CID 120692677
(E)-2-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]hex-4-enoic acid (PubChem CID 120692677) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (E)-2-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120692677 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (E)-2-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)Cc1c[nH]c2ccc(OC)cc12)C(=O)O |
| InChI | InChI=1S/C17H20N2O4/c1-3-4-5-15(17(21)22)19-16(20)8-11-10-18-14-7-6-12(23-2)9-13(11)14/h3-4,6-7,9-10,15,18H,5,8H2,1-2H3,(H,19,20)(H,21,22)/b4-3+ |
| InChIKey | HYFVSHXKSJQXQH-ONEGZZNKSA-N |
| XLogP | 2.25 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|