C19H25N3O5 — CID 120694580
(2S)-2-[[2-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 120694580) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is (2S)-2-[[2-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120694580 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (2S)-2-[[2-[[2-(5-methoxy-1H-indol-3-yl)acetyl]amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | COc1ccc2[nH]cc(CC(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)O)c2c1 |
| InChI | InChI=1S/C19H25N3O5/c1-11(2)6-16(19(25)26)22-18(24)10-21-17(23)7-12-9-20-15-5-4-13(27-3)8-14(12)15/h4-5,8-9,11,16,20H,6-7,10H2,1-3H3,(H,21,23)(H,22,24)(H,25,26)/t16-/m0/s1 |
| InChIKey | YBNXZLFLGUDRPE-INIZCTEOSA-N |
| XLogP | 1.45 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |