C13H16FNO5 — CID 61153383
(2S)-2-[4-(4-fluorophenoxy)butanoylamino]-3-hydroxypropanoic acid (PubChem CID 61153383) has the molecular formula C13H16FNO5 and a molecular weight of 285.27 g/mol. Its IUPAC name is (2S)-2-[4-(4-fluorophenoxy)butanoylamino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[4-(4-fluorophenoxy)butanoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 61153383 |
| Molecular Formula | C13H16FNO5 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (2S)-2-[4-(4-fluorophenoxy)butanoylamino]-3-hydroxypropanoic acid |
| SMILES | O=C(CCCOc1ccc(F)cc1)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C13H16FNO5/c14-9-3-5-10(6-4-9)20-7-1-2-12(17)15-11(8-16)13(18)19/h3-6,11,16H,1-2,7-8H2,(H,15,17)(H,18,19)/t11-/m0/s1 |
| InChIKey | FTEHBMUYMVHWOG-NSHDSACASA-N |
| XLogP | 0.55 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|