C13H18FNO4 — CID 66177314
N-(2,3-dihydroxypropyl)-4-(4-fluorophenoxy)butanamide (PubChem CID 66177314) has the molecular formula C13H18FNO4 and a molecular weight of 271.29 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-4-(4-fluorophenoxy)butanamide.
| Compound Name | N-(2,3-dihydroxypropyl)-4-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 66177314 |
| Molecular Formula | C13H18FNO4 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-4-(4-fluorophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(F)cc1)NCC(O)CO |
| InChI | InChI=1S/C13H18FNO4/c14-10-3-5-12(6-4-10)19-7-1-2-13(18)15-8-11(17)9-16/h3-6,11,16-17H,1-2,7-9H2,(H,15,18) |
| InChIKey | PXAKRTZKHAODAS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|