C16H24FNO3 — CID 103772535
4-(4-fluorophenoxy)-N-(4-hydroxy-2,2-dimethylbutyl)butanamide (PubChem CID 103772535) has the molecular formula C16H24FNO3 and a molecular weight of 297.37 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N-(4-hydroxy-2,2-dimethylbutyl)butanamide.
| Compound Name | 4-(4-fluorophenoxy)-N-(4-hydroxy-2,2-dimethylbutyl)butanamide |
|---|---|
| PubChem CID | 103772535 |
| Molecular Formula | C16H24FNO3 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4-(4-fluorophenoxy)-N-(4-hydroxy-2,2-dimethylbutyl)butanamide |
| SMILES | CC(C)(CCO)CNC(=O)CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C16H24FNO3/c1-16(2,9-10-19)12-18-15(20)4-3-11-21-14-7-5-13(17)6-8-14/h5-8,19H,3-4,9-12H2,1-2H3,(H,18,20) |
| InChIKey | RXYZOXUCPHADDO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|