C12H16FNO4 — CID 66175386
N-(2,3-dihydroxypropyl)-3-(4-fluorophenoxy)propanamide (PubChem CID 66175386) has the molecular formula C12H16FNO4 and a molecular weight of 257.26 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-3-(4-fluorophenoxy)propanamide.
| Compound Name | N-(2,3-dihydroxypropyl)-3-(4-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 66175386 |
| Molecular Formula | C12H16FNO4 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-3-(4-fluorophenoxy)propanamide |
| SMILES | O=C(CCOc1ccc(F)cc1)NCC(O)CO |
| InChI | InChI=1S/C12H16FNO4/c13-9-1-3-11(4-2-9)18-6-5-12(17)14-7-10(16)8-15/h1-4,10,15-16H,5-8H2,(H,14,17) |
| InChIKey | UJRLJXNUOFUXBL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |