C12H16ClNO4 — CID 66177946
3-(3-chlorophenoxy)-N-(2,3-dihydroxypropyl)propanamide (PubChem CID 66177946) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is 3-(3-chlorophenoxy)-N-(2,3-dihydroxypropyl)propanamide.
| Compound Name | 3-(3-chlorophenoxy)-N-(2,3-dihydroxypropyl)propanamide |
|---|---|
| PubChem CID | 66177946 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-(3-chlorophenoxy)-N-(2,3-dihydroxypropyl)propanamide |
| SMILES | O=C(CCOc1cccc(Cl)c1)NCC(O)CO |
| InChI | InChI=1S/C12H16ClNO4/c13-9-2-1-3-11(6-9)18-5-4-12(17)14-7-10(16)8-15/h1-3,6,10,15-16H,4-5,7-8H2,(H,14,17) |
| InChIKey | NZZSDXSRAZSQRG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |