C14H15BrFNO4 — CID 120692919
(E)-2-[[2-(2-bromo-4-fluorophenoxy)acetyl]amino]hex-4-enoic acid (PubChem CID 120692919) has the molecular formula C14H15BrFNO4 and a molecular weight of 360.18 g/mol. Its IUPAC name is (E)-2-[[2-(2-bromo-4-fluorophenoxy)acetyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[2-(2-bromo-4-fluorophenoxy)acetyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120692919 |
| Molecular Formula | C14H15BrFNO4 |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | (E)-2-[[2-(2-bromo-4-fluorophenoxy)acetyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)COc1ccc(F)cc1Br)C(=O)O |
| InChI | InChI=1S/C14H15BrFNO4/c1-2-3-4-11(14(19)20)17-13(18)8-21-12-6-5-9(16)7-10(12)15/h2-3,5-7,11H,4,8H2,1H3,(H,17,18)(H,19,20)/b3-2+ |
| InChIKey | ZDYHKMPOSUDMDW-NSCUHMNNSA-N |
| XLogP | 2.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|