C13H15BrFNO4 — CID 61344943
ethyl 2-[[2-(2-bromo-4-fluorophenoxy)acetyl]amino]propanoate (PubChem CID 61344943) has the molecular formula C13H15BrFNO4 and a molecular weight of 348.17 g/mol. Its IUPAC name is ethyl 2-[[2-(2-bromo-4-fluorophenoxy)acetyl]amino]propanoate.
| Compound Name | ethyl 2-[[2-(2-bromo-4-fluorophenoxy)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 61344943 |
| Molecular Formula | C13H15BrFNO4 |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | ethyl 2-[[2-(2-bromo-4-fluorophenoxy)acetyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)COc1ccc(F)cc1Br |
| InChI | InChI=1S/C13H15BrFNO4/c1-3-19-13(18)8(2)16-12(17)7-20-11-5-4-9(15)6-10(11)14/h4-6,8H,3,7H2,1-2H3,(H,16,17) |
| InChIKey | ZEXOGEWVDVROFC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |