C9H9BrFNO3 — CID 51279328
2-(2-bromo-4-fluorophenoxy)-N-methoxyacetamide (PubChem CID 51279328) has the molecular formula C9H9BrFNO3 and a molecular weight of 278.08 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenoxy)-N-methoxyacetamide.
| Compound Name | 2-(2-bromo-4-fluorophenoxy)-N-methoxyacetamide |
|---|---|
| PubChem CID | 51279328 |
| Molecular Formula | C9H9BrFNO3 |
| Molecular Weight | 278.08 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | 2-(2-bromo-4-fluorophenoxy)-N-methoxyacetamide |
| SMILES | CONC(=O)COc1ccc(F)cc1Br |
| InChI | InChI=1S/C9H9BrFNO3/c1-14-12-9(13)5-15-8-3-2-6(11)4-7(8)10/h2-4H,5H2,1H3,(H,12,13) |
| InChIKey | FVYAJIXPMWLKTN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.08 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|