C15H17ClFNO4 — CID 120693276
(E)-2-[2-(2-chloro-4-fluorophenoxy)propanoylamino]hex-4-enoic acid (PubChem CID 120693276) has the molecular formula C15H17ClFNO4 and a molecular weight of 329.76 g/mol. Its IUPAC name is (E)-2-[2-(2-chloro-4-fluorophenoxy)propanoylamino]hex-4-enoic acid.
| Compound Name | (E)-2-[2-(2-chloro-4-fluorophenoxy)propanoylamino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693276 |
| Molecular Formula | C15H17ClFNO4 |
| Molecular Weight | 329.76 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | (E)-2-[2-(2-chloro-4-fluorophenoxy)propanoylamino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)C(C)Oc1ccc(F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C15H17ClFNO4/c1-3-4-5-12(15(20)21)18-14(19)9(2)22-13-7-6-10(17)8-11(13)16/h3-4,6-9,12H,5H2,1-2H3,(H,18,19)(H,20,21)/b4-3+ |
| InChIKey | LQIZCRVGPUZHCB-ONEGZZNKSA-N |
| XLogP | 2.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.76 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|