C14H19ClFNO3 — CID 96532897
(2R)-2-(2-chloro-4-fluorophenoxy)-N-[(2S)-4-methoxybutan-2-yl]propanamide (PubChem CID 96532897) has the molecular formula C14H19ClFNO3 and a molecular weight of 303.76 g/mol. Its IUPAC name is (2R)-2-(2-chloro-4-fluorophenoxy)-N-[(2S)-4-methoxybutan-2-yl]propanamide.
| Compound Name | (2R)-2-(2-chloro-4-fluorophenoxy)-N-[(2S)-4-methoxybutan-2-yl]propanamide |
|---|---|
| PubChem CID | 96532897 |
| Molecular Formula | C14H19ClFNO3 |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (2R)-2-(2-chloro-4-fluorophenoxy)-N-[(2S)-4-methoxybutan-2-yl]propanamide |
| SMILES | COCC[C@H](C)NC(=O)[C@@H](C)Oc1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H19ClFNO3/c1-9(6-7-19-3)17-14(18)10(2)20-13-5-4-11(16)8-12(13)15/h4-5,8-10H,6-7H2,1-3H3,(H,17,18)/t9-,10+/m0/s1 |
| InChIKey | OGXFEAVBGKQZDQ-VHSXEESVSA-N |
| XLogP | 2.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |