C10H12ClFN2O3 — CID 103229273
2-(2-chloro-4-fluorophenoxy)-3-methoxypropanehydrazide (PubChem CID 103229273) has the molecular formula C10H12ClFN2O3 and a molecular weight of 262.67 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-3-methoxypropanehydrazide.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-3-methoxypropanehydrazide |
|---|---|
| PubChem CID | 103229273 |
| Molecular Formula | C10H12ClFN2O3 |
| Molecular Weight | 262.67 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-3-methoxypropanehydrazide |
| SMILES | COCC(Oc1ccc(F)cc1Cl)C(=O)NN |
| InChI | InChI=1S/C10H12ClFN2O3/c1-16-5-9(10(15)14-13)17-8-3-2-6(12)4-7(8)11/h2-4,9H,5,13H2,1H3,(H,14,15) |
| InChIKey | QFFUIUJXXQEXAB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.67 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|