C12H18N2O5 — CID 107744970
2-[4-(hydroxymethyl)-2-methoxyphenoxy]-3-methoxypropanehydrazide (PubChem CID 107744970) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-[4-(hydroxymethyl)-2-methoxyphenoxy]-3-methoxypropanehydrazide.
| Compound Name | 2-[4-(hydroxymethyl)-2-methoxyphenoxy]-3-methoxypropanehydrazide |
|---|---|
| PubChem CID | 107744970 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[4-(hydroxymethyl)-2-methoxyphenoxy]-3-methoxypropanehydrazide |
| SMILES | COCC(Oc1ccc(CO)cc1OC)C(=O)NN |
| InChI | InChI=1S/C12H18N2O5/c1-17-7-11(12(16)14-13)19-9-4-3-8(6-15)5-10(9)18-2/h3-5,11,15H,6-7,13H2,1-2H3,(H,14,16) |
| InChIKey | KTARUOLGEQFFEW-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|