C17H25Cl2NO2 — CID 3347713
2-(2,4-dichlorophenoxy)-N-(6-methylheptan-2-yl)propanamide (PubChem CID 3347713) has the molecular formula C17H25Cl2NO2 and a molecular weight of 346.30 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(6-methylheptan-2-yl)propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(6-methylheptan-2-yl)propanamide |
|---|---|
| PubChem CID | 3347713 |
| Molecular Formula | C17H25Cl2NO2 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(6-methylheptan-2-yl)propanamide |
| SMILES | CC(C)CCCC(C)NC(=O)C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H25Cl2NO2/c1-11(2)6-5-7-12(3)20-17(21)13(4)22-16-9-8-14(18)10-15(16)19/h8-13H,5-7H2,1-4H3,(H,20,21) |
| InChIKey | CVWCFYIDKQUUSK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |