C11H13Cl2NO3 — CID 30690113
(2R)-2-(2,4-dichlorophenoxy)-N-ethoxypropanamide (PubChem CID 30690113) has the molecular formula C11H13Cl2NO3 and a molecular weight of 278.14 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenoxy)-N-ethoxypropanamide.
| Compound Name | (2R)-2-(2,4-dichlorophenoxy)-N-ethoxypropanamide |
|---|---|
| PubChem CID | 30690113 |
| Molecular Formula | C11H13Cl2NO3 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenoxy)-N-ethoxypropanamide |
| SMILES | CCONC(=O)[C@@H](C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2NO3/c1-3-16-14-11(15)7(2)17-10-5-4-8(12)6-9(10)13/h4-7H,3H2,1-2H3,(H,14,15)/t7-/m1/s1 |
| InChIKey | XHEPUOHJCCYZBY-SSDOTTSWSA-N |
| XLogP | 2.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|