C15H18Cl2N2O4 — CID 3329057
ethyl 3-[2-(2,4-dichlorophenoxy)propanoylhydrazinylidene]butanoate (PubChem CID 3329057) has the molecular formula C15H18Cl2N2O4 and a molecular weight of 361.23 g/mol. Its IUPAC name is ethyl 3-[2-(2,4-dichlorophenoxy)propanoylhydrazinylidene]butanoate.
| Compound Name | ethyl 3-[2-(2,4-dichlorophenoxy)propanoylhydrazinylidene]butanoate |
|---|---|
| PubChem CID | 3329057 |
| Molecular Formula | C15H18Cl2N2O4 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | ethyl 3-[2-(2,4-dichlorophenoxy)propanoylhydrazinylidene]butanoate |
| SMILES | CCOC(=O)CC(C)=NNC(=O)C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H18Cl2N2O4/c1-4-22-14(20)7-9(2)18-19-15(21)10(3)23-13-6-5-11(16)8-12(13)17/h5-6,8,10H,4,7H2,1-3H3,(H,19,21) |
| InChIKey | VLALATSGHYACJC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|