C21H18Cl2N2O2 — CID 7114974
(2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-1-naphthalen-2-ylethylideneamino]propanamide (PubChem CID 7114974) has the molecular formula C21H18Cl2N2O2 and a molecular weight of 401.29 g/mol. Its IUPAC name is (2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-1-naphthalen-2-ylethylideneamino]propanamide.
| Compound Name | (2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-1-naphthalen-2-ylethylideneamino]propanamide |
|---|---|
| PubChem CID | 7114974 |
| Molecular Formula | C21H18Cl2N2O2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (2S)-2-(2,4-dichlorophenoxy)-N-[(Z)-1-naphthalen-2-ylethylideneamino]propanamide |
| SMILES | C/C(=N/NC(=O)[C@H](C)Oc1ccc(Cl)cc1Cl)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H18Cl2N2O2/c1-13(16-8-7-15-5-3-4-6-17(15)11-16)24-25-21(26)14(2)27-20-10-9-18(22)12-19(20)23/h3-12,14H,1-2H3,(H,25,26)/b24-13-/t14-/m0/s1 |
| InChIKey | KDVRLZNPYJJPBR-ARCFYCQJSA-N |
| XLogP | 5.45 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|