C19H16Cl2F3N3O3 — CID 6265635
2-(2,4-dichlorophenoxy)-N-[(Z)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]propanamide (PubChem CID 6265635) has the molecular formula C19H16Cl2F3N3O3 and a molecular weight of 462.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(Z)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(Z)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]propanamide |
|---|---|
| PubChem CID | 6265635 |
| Molecular Formula | C19H16Cl2F3N3O3 |
| Molecular Weight | 462.26 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(Z)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]propanamide |
| SMILES | C/C(=N/NC(=O)C(C)Oc1ccc(Cl)cc1Cl)c1cccc(NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16Cl2F3N3O3/c1-10(12-4-3-5-14(8-12)25-18(29)19(22,23)24)26-27-17(28)11(2)30-16-7-6-13(20)9-15(16)21/h3-9,11H,1-2H3,(H,25,29)(H,27,28)/b26-10- |
| InChIKey | WEBZUPOVJXSEDG-KALUYTGESA-N |
| XLogP | 4.80 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.26 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|