C22H26N4O5 — CID 27526172
2,2-dimethyl-N-[3-[(Z)-C-methyl-N-[[(2R)-2-(2-nitrophenoxy)propanoyl]amino]carbonimidoyl]phenyl]propanamide (PubChem CID 27526172) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2,2-dimethyl-N-[3-[(Z)-C-methyl-N-[[(2R)-2-(2-nitrophenoxy)propanoyl]amino]carbonimidoyl]phenyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[3-[(Z)-C-methyl-N-[[(2R)-2-(2-nitrophenoxy)propanoyl]amino]carbonimidoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 27526172 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2,2-dimethyl-N-[3-[(Z)-C-methyl-N-[[(2R)-2-(2-nitrophenoxy)propanoyl]amino]carbonimidoyl]phenyl]propanamide |
| SMILES | C/C(=N/NC(=O)[C@@H](C)Oc1ccccc1[N+](=O)[O-])c1cccc(NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C22H26N4O5/c1-14(16-9-8-10-17(13-16)23-21(28)22(3,4)5)24-25-20(27)15(2)31-19-12-7-6-11-18(19)26(29)30/h6-13,15H,1-5H3,(H,23,28)(H,25,27)/b24-14-/t15-/m1/s1 |
| InChIKey | KNYIQJFBDZQFSR-CPISYKEBSA-N |
| XLogP | 3.89 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|