C23H22N4O6 — CID 5433756
5-methyl-N-[3-[(Z)-C-methyl-N-[[(2S)-2-(2-nitrophenoxy)propanoyl]amino]carbonimidoyl]phenyl]furan-2-carboxamide (PubChem CID 5433756) has the molecular formula C23H22N4O6 and a molecular weight of 450.45 g/mol. Its IUPAC name is 5-methyl-N-[3-[(Z)-C-methyl-N-[[(2S)-2-(2-nitrophenoxy)propanoyl]amino]carbonimidoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-methyl-N-[3-[(Z)-C-methyl-N-[[(2S)-2-(2-nitrophenoxy)propanoyl]amino]carbonimidoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 5433756 |
| Molecular Formula | C23H22N4O6 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 5-methyl-N-[3-[(Z)-C-methyl-N-[[(2S)-2-(2-nitrophenoxy)propanoyl]amino]carbonimidoyl]phenyl]furan-2-carboxamide |
| SMILES | C/C(=N/NC(=O)[C@H](C)Oc1ccccc1[N+](=O)[O-])c1cccc(NC(=O)c2ccc(C)o2)c1 |
| InChI | InChI=1S/C23H22N4O6/c1-14-11-12-21(32-14)23(29)24-18-8-6-7-17(13-18)15(2)25-26-22(28)16(3)33-20-10-5-4-9-19(20)27(30)31/h4-13,16H,1-3H3,(H,24,29)(H,26,28)/b25-15-/t16-/m0/s1 |
| InChIKey | ACLQRGUPDVETAX-GMQKBEEJSA-N |
| XLogP | 4.06 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|